C9H13Cl2N5 — CID 159416962
1-(4-chlorophenyl)-3-(diaminomethylidene)-1-methylguanidine;hydrochloride (PubChem CID 159416962) has the molecular formula C9H13Cl2N5 and a molecular weight of 262.14 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(diaminomethylidene)-1-methylguanidine;hydrochloride.
| Compound Name | 1-(4-chlorophenyl)-3-(diaminomethylidene)-1-methylguanidine;hydrochloride |
|---|---|
| PubChem CID | 159416962 |
| Molecular Formula | C9H13Cl2N5 |
| Molecular Weight | 262.14 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(diaminomethylidene)-1-methylguanidine;hydrochloride |
| SMILES | Cl.[H]/N=C(\N=C(N)N)N(C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H12ClN5.ClH/c1-15(9(13)14-8(11)12)7-4-2-6(10)3-5-7;/h2-5H,1H3,(H5,11,12,13,14);1H |
| InChIKey | LPGXYATWGKRFTB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.14 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|