C14H21FN4O — CID 20543370
(1Z)-1-[amino-(2-fluoro-N,4-dimethylanilino)methylidene]-3-tert-butylurea (PubChem CID 20543370) has the molecular formula C14H21FN4O and a molecular weight of 280.35 g/mol. Its IUPAC name is (1Z)-1-[amino-(2-fluoro-N,4-dimethylanilino)methylidene]-3-tert-butylurea.
| Compound Name | (1Z)-1-[amino-(2-fluoro-N,4-dimethylanilino)methylidene]-3-tert-butylurea |
|---|---|
| PubChem CID | 20543370 |
| Molecular Formula | C14H21FN4O |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (1Z)-1-[amino-(2-fluoro-N,4-dimethylanilino)methylidene]-3-tert-butylurea |
| SMILES | Cc1ccc(N(C)/C(N)=N\C(=O)NC(C)(C)C)c(F)c1 |
| InChI | InChI=1S/C14H21FN4O/c1-9-6-7-11(10(15)8-9)19(5)12(16)17-13(20)18-14(2,3)4/h6-8H,1-5H3,(H3,16,17,18,20) |
| InChIKey | VFZAWEOHJIDSPN-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|