C13H18FNO — CID 123320103
N-tert-butyl-2-fluoro-N,4-dimethylbenzamide (PubChem CID 123320103) has the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. Its IUPAC name is N-tert-butyl-2-fluoro-N,4-dimethylbenzamide.
| Compound Name | N-tert-butyl-2-fluoro-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 123320103 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | N-tert-butyl-2-fluoro-N,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C)C(C)(C)C)c(F)c1 |
| InChI | InChI=1S/C13H18FNO/c1-9-6-7-10(11(14)8-9)12(16)15(5)13(2,3)4/h6-8H,1-5H3 |
| InChIKey | LZQQECGPYMTHAW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |