C17H18FNO — CID 79776952
N-(3,5-dimethylphenyl)-2-fluoro-N,4-dimethylbenzamide (PubChem CID 79776952) has the molecular formula C17H18FNO and a molecular weight of 271.33 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-fluoro-N,4-dimethylbenzamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-fluoro-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 79776952 |
| Molecular Formula | C17H18FNO |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-fluoro-N,4-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(N(C)C(=O)c2ccc(C)cc2F)c1 |
| InChI | InChI=1S/C17H18FNO/c1-11-5-6-15(16(18)10-11)17(20)19(4)14-8-12(2)7-13(3)9-14/h5-10H,1-4H3 |
| InChIKey | AVTJWPNAMAFXIL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |