About N-(3,5-dimethylphenyl)-2-hydrazinyl-N,5-dimethylbenzamide
N-(3,5-dimethylphenyl)-2-hydrazinyl-N,5-dimethylbenzamide (PubChem CID 62512821) has the molecular formula C17H21N3O
and a molecular weight of 283.38 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-hydrazinyl-N,5-dimethylbenzamide.
Molecular Properties
| Compound Name | N-(3,5-dimethylphenyl)-2-hydrazinyl-N,5-dimethylbenzamide |
| PubChem CID | 62512821 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-hydrazinyl-N,5-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(N(C)C(=O)c2cc(C)ccc2NN)c1 |
| InChI | InChI=1S/C17H21N3O/c1-11-5-6-16(19-18)15(10-11)17(21)20(4)14-8-12(2)7-13(3)9-14/h5-10,19H,18H2,1-4H3 |
| InChIKey | OYARNTIWGUAEEP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3,5-dimethylphenyl)-2-hydrazinyl-N,5-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dimethylphenyl)-2-hydrazinyl-N,5-dimethylbenzamide?
The IUPAC name of N-(3,5-dimethylphenyl)-2-hydrazinyl-N,5-dimethylbenzamide (CID 62512821) is N-(3,5-dimethylphenyl)-2-hydrazinyl-N,5-dimethylbenzamide.
What is the SMILES notation for N-(3,5-dimethylphenyl)-2-hydrazinyl-N,5-dimethylbenzamide?
The canonical SMILES for N-(3,5-dimethylphenyl)-2-hydrazinyl-N,5-dimethylbenzamide is Cc1cc(C)cc(N(C)C(=O)c2cc(C)ccc2NN)c1.
What is the InChIKey of N-(3,5-dimethylphenyl)-2-hydrazinyl-N,5-dimethylbenzamide?
The InChIKey is OYARNTIWGUAEEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O/c1-11-5-6-16(19-18)15(10-11)17(21)20(4)14-8-12(2)7-13(3)9-14/h5-10,19H,18H2,1-4H3.
What are the key properties of N-(3,5-dimethylphenyl)-2-hydrazinyl-N,5-dimethylbenzamide?
N-(3,5-dimethylphenyl)-2-hydrazinyl-N,5-dimethylbenzamide has a molecular weight of 283.38 g/mol, XLogP of 3.17, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dimethylphenyl)-2-hydrazinyl-N,5-dimethylbenzamide is sourced from PubChem (CID 62512821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).