C13H22N4O — CID 63726038
N-[2-(dimethylamino)ethyl]-2-hydrazinyl-N,5-dimethylbenzamide (PubChem CID 63726038) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-2-hydrazinyl-N,5-dimethylbenzamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-2-hydrazinyl-N,5-dimethylbenzamide |
|---|---|
| PubChem CID | 63726038 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-2-hydrazinyl-N,5-dimethylbenzamide |
| SMILES | Cc1ccc(NN)c(C(=O)N(C)CCN(C)C)c1 |
| InChI | InChI=1S/C13H22N4O/c1-10-5-6-12(15-14)11(9-10)13(18)17(4)8-7-16(2)3/h5-6,9,15H,7-8,14H2,1-4H3 |
| InChIKey | YAFKHQVYULFUOF-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|