C14H21N5O3 — CID 20543396
(1Z)-1-[amino-(N,2-dimethyl-4-nitroanilino)methylidene]-3-tert-butylurea (PubChem CID 20543396) has the molecular formula C14H21N5O3 and a molecular weight of 307.35 g/mol. Its IUPAC name is (1Z)-1-[amino-(N,2-dimethyl-4-nitroanilino)methylidene]-3-tert-butylurea.
| Compound Name | (1Z)-1-[amino-(N,2-dimethyl-4-nitroanilino)methylidene]-3-tert-butylurea |
|---|---|
| PubChem CID | 20543396 |
| Molecular Formula | C14H21N5O3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (1Z)-1-[amino-(N,2-dimethyl-4-nitroanilino)methylidene]-3-tert-butylurea |
| SMILES | Cc1cc([N+](=O)[O-])ccc1N(C)/C(N)=N\C(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H21N5O3/c1-9-8-10(19(21)22)6-7-11(9)18(5)12(15)16-13(20)17-14(2,3)4/h6-8H,1-5H3,(H3,15,16,17,20) |
| InChIKey | SBEKWNBEHYHGLJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 113.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|