C14H22N2O — CID 115695066
3-tert-butyl-1-(2,4-dimethylphenyl)-1-methylurea (PubChem CID 115695066) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 3-tert-butyl-1-(2,4-dimethylphenyl)-1-methylurea.
| Compound Name | 3-tert-butyl-1-(2,4-dimethylphenyl)-1-methylurea |
|---|---|
| PubChem CID | 115695066 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 3-tert-butyl-1-(2,4-dimethylphenyl)-1-methylurea |
| SMILES | Cc1ccc(N(C)C(=O)NC(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C14H22N2O/c1-10-7-8-12(11(2)9-10)16(6)13(17)15-14(3,4)5/h7-9H,1-6H3,(H,15,17) |
| InChIKey | MVKWQGBAIOYIRZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |