C12H17NO2 — CID 115138834
N-(2,4-dimethylphenyl)-3-hydroxy-N-methylpropanamide (PubChem CID 115138834) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-3-hydroxy-N-methylpropanamide.
| Compound Name | N-(2,4-dimethylphenyl)-3-hydroxy-N-methylpropanamide |
|---|---|
| PubChem CID | 115138834 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | N-(2,4-dimethylphenyl)-3-hydroxy-N-methylpropanamide |
| SMILES | Cc1ccc(N(C)C(=O)CCO)c(C)c1 |
| InChI | InChI=1S/C12H17NO2/c1-9-4-5-11(10(2)8-9)13(3)12(15)6-7-14/h4-5,8,14H,6-7H2,1-3H3 |
| InChIKey | RFSDTXYAIPFGRL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |