C13H19NO2 — CID 79193265
N-(2,4-dimethylphenyl)-4-hydroxy-N-methylbutanamide (PubChem CID 79193265) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-4-hydroxy-N-methylbutanamide.
| Compound Name | N-(2,4-dimethylphenyl)-4-hydroxy-N-methylbutanamide |
|---|---|
| PubChem CID | 79193265 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | N-(2,4-dimethylphenyl)-4-hydroxy-N-methylbutanamide |
| SMILES | Cc1ccc(N(C)C(=O)CCCO)c(C)c1 |
| InChI | InChI=1S/C13H19NO2/c1-10-6-7-12(11(2)9-10)14(3)13(16)5-4-8-15/h6-7,9,15H,4-5,8H2,1-3H3 |
| InChIKey | UPSUZTPFRGOBDH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |