C19H23NO — CID 60538754
N-(2,5-dimethylphenyl)-N-methyl-4-phenylbutanamide (PubChem CID 60538754) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-N-methyl-4-phenylbutanamide.
| Compound Name | N-(2,5-dimethylphenyl)-N-methyl-4-phenylbutanamide |
|---|---|
| PubChem CID | 60538754 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | N-(2,5-dimethylphenyl)-N-methyl-4-phenylbutanamide |
| SMILES | Cc1ccc(C)c(N(C)C(=O)CCCc2ccccc2)c1 |
| InChI | InChI=1S/C19H23NO/c1-15-12-13-16(2)18(14-15)20(3)19(21)11-7-10-17-8-5-4-6-9-17/h4-6,8-9,12-14H,7,10-11H2,1-3H3 |
| InChIKey | BTHOVZLHACGSHN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |