C15H24N2O — CID 115157531
4-amino-N-(2,5-dimethylphenyl)-N,4-dimethylpentanamide (PubChem CID 115157531) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 4-amino-N-(2,5-dimethylphenyl)-N,4-dimethylpentanamide.
| Compound Name | 4-amino-N-(2,5-dimethylphenyl)-N,4-dimethylpentanamide |
|---|---|
| PubChem CID | 115157531 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 4-amino-N-(2,5-dimethylphenyl)-N,4-dimethylpentanamide |
| SMILES | Cc1ccc(C)c(N(C)C(=O)CCC(C)(C)N)c1 |
| InChI | InChI=1S/C15H24N2O/c1-11-6-7-12(2)13(10-11)17(5)14(18)8-9-15(3,4)16/h6-7,10H,8-9,16H2,1-5H3 |
| InChIKey | OGDUYBFSBSGTKP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |