C11H16N4O — CID 57266541
[amino-(N,2,4-trimethylanilino)methylidene]urea (PubChem CID 57266541) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is [amino-(N,2,4-trimethylanilino)methylidene]urea.
| Compound Name | [amino-(N,2,4-trimethylanilino)methylidene]urea |
|---|---|
| PubChem CID | 57266541 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | [amino-(N,2,4-trimethylanilino)methylidene]urea |
| SMILES | Cc1ccc(N(C)C(N)=NC(N)=O)c(C)c1 |
| InChI | InChI=1S/C11H16N4O/c1-7-4-5-9(8(2)6-7)15(3)10(12)14-11(13)16/h4-6H,1-3H3,(H4,12,13,14,16) |
| InChIKey | WBBRORXZHFVNFH-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|