C10H13FN4O — CID 57257094
[amino-(2-fluoro-N,6-dimethylanilino)methylidene]urea (PubChem CID 57257094) has the molecular formula C10H13FN4O and a molecular weight of 224.24 g/mol. Its IUPAC name is [amino-(2-fluoro-N,6-dimethylanilino)methylidene]urea.
| Compound Name | [amino-(2-fluoro-N,6-dimethylanilino)methylidene]urea |
|---|---|
| PubChem CID | 57257094 |
| Molecular Formula | C10H13FN4O |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | [amino-(2-fluoro-N,6-dimethylanilino)methylidene]urea |
| SMILES | Cc1cccc(F)c1N(C)C(N)=NC(N)=O |
| InChI | InChI=1S/C10H13FN4O/c1-6-4-3-5-7(11)8(6)15(2)9(12)14-10(13)16/h3-5H,1-2H3,(H4,12,13,14,16) |
| InChIKey | VPRYXANJKSOILH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|