C15H10F4N2O2 — CID 91650502
N-(2-carbamoyl-6-fluorophenyl)-2,4,5-trifluoro-N-methylbenzamide (PubChem CID 91650502) has the molecular formula C15H10F4N2O2 and a molecular weight of 326.25 g/mol. Its IUPAC name is N-(2-carbamoyl-6-fluorophenyl)-2,4,5-trifluoro-N-methylbenzamide.
| Compound Name | N-(2-carbamoyl-6-fluorophenyl)-2,4,5-trifluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 91650502 |
| Molecular Formula | C15H10F4N2O2 |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | N-(2-carbamoyl-6-fluorophenyl)-2,4,5-trifluoro-N-methylbenzamide |
| SMILES | CN(C(=O)c1cc(F)c(F)cc1F)c1c(F)cccc1C(N)=O |
| InChI | InChI=1S/C15H10F4N2O2/c1-21(13-7(14(20)22)3-2-4-9(13)16)15(23)8-5-11(18)12(19)6-10(8)17/h2-6H,1H3,(H2,20,22) |
| InChIKey | LWVJWAQQJHAGTA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|