C9H10F2N2O — CID 28794668
2-amino-N-(2,6-difluorophenyl)-N-methylacetamide (PubChem CID 28794668) has the molecular formula C9H10F2N2O and a molecular weight of 200.19 g/mol. Its IUPAC name is 2-amino-N-(2,6-difluorophenyl)-N-methylacetamide.
| Compound Name | 2-amino-N-(2,6-difluorophenyl)-N-methylacetamide |
|---|---|
| PubChem CID | 28794668 |
| Molecular Formula | C9H10F2N2O |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 2-amino-N-(2,6-difluorophenyl)-N-methylacetamide |
| SMILES | CN(C(=O)CN)c1c(F)cccc1F |
| InChI | InChI=1S/C9H10F2N2O/c1-13(8(14)5-12)9-6(10)3-2-4-7(9)11/h2-4H,5,12H2,1H3 |
| InChIKey | MVLKFGOEQHAKDU-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |