C10H12F2N2O — CID 61350833
N-(2-aminoethyl)-2,6-difluoro-N-methylbenzamide (PubChem CID 61350833) has the molecular formula C10H12F2N2O and a molecular weight of 214.22 g/mol. Its IUPAC name is N-(2-aminoethyl)-2,6-difluoro-N-methylbenzamide.
| Compound Name | N-(2-aminoethyl)-2,6-difluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 61350833 |
| Molecular Formula | C10H12F2N2O |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | N-(2-aminoethyl)-2,6-difluoro-N-methylbenzamide |
| SMILES | CN(CCN)C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C10H12F2N2O/c1-14(6-5-13)10(15)9-7(11)3-2-4-8(9)12/h2-4H,5-6,13H2,1H3 |
| InChIKey | UWZVOBOLTGJFTL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |