About N-(2-aminoethyl)-2,6-difluoro-N-methylbenzamide
N-(2-aminoethyl)-2,6-difluoro-N-methylbenzamide (PubChem CID 61350833) has the molecular formula C10H12F2N2O
and a molecular weight of 214.22 g/mol. Its IUPAC name is N-(2-aminoethyl)-2,6-difluoro-N-methylbenzamide.
Molecular Properties
| Compound Name | N-(2-aminoethyl)-2,6-difluoro-N-methylbenzamide |
| PubChem CID | 61350833 |
| Molecular Formula | C10H12F2N2O |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | N-(2-aminoethyl)-2,6-difluoro-N-methylbenzamide |
| SMILES | CN(CCN)C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C10H12F2N2O/c1-14(6-5-13)10(15)9-7(11)3-2-4-8(9)12/h2-4H,5-6,13H2,1H3 |
| InChIKey | UWZVOBOLTGJFTL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(2-aminoethyl)-2,6-difluoro-N-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminoethyl)-2,6-difluoro-N-methylbenzamide?
The IUPAC name of N-(2-aminoethyl)-2,6-difluoro-N-methylbenzamide (CID 61350833) is N-(2-aminoethyl)-2,6-difluoro-N-methylbenzamide.
What is the SMILES notation for N-(2-aminoethyl)-2,6-difluoro-N-methylbenzamide?
The canonical SMILES for N-(2-aminoethyl)-2,6-difluoro-N-methylbenzamide is CN(CCN)C(=O)c1c(F)cccc1F.
What is the InChIKey of N-(2-aminoethyl)-2,6-difluoro-N-methylbenzamide?
The InChIKey is UWZVOBOLTGJFTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F2N2O/c1-14(6-5-13)10(15)9-7(11)3-2-4-8(9)12/h2-4H,5-6,13H2,1H3.
What are the key properties of N-(2-aminoethyl)-2,6-difluoro-N-methylbenzamide?
N-(2-aminoethyl)-2,6-difluoro-N-methylbenzamide has a molecular weight of 214.22 g/mol, XLogP of 1.00, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminoethyl)-2,6-difluoro-N-methylbenzamide is sourced from PubChem (CID 61350833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).