C8H8F2N2O — CID 54144857
N-(2,6-difluorophenyl)acetohydrazide (PubChem CID 54144857) has the molecular formula C8H8F2N2O and a molecular weight of 186.16 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)acetohydrazide.
| Compound Name | N-(2,6-difluorophenyl)acetohydrazide |
|---|---|
| PubChem CID | 54144857 |
| Molecular Formula | C8H8F2N2O |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | N-(2,6-difluorophenyl)acetohydrazide |
| SMILES | CC(=O)N(N)c1c(F)cccc1F |
| InChI | InChI=1S/C8H8F2N2O/c1-5(13)12(11)8-6(9)3-2-4-7(8)10/h2-4H,11H2,1H3 |
| InChIKey | ODQIHBVVNGFWOF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|