C13H6F4O — CID 103301189
(2-fluorophenyl)-(2,4,5-trifluorophenyl)methanone (PubChem CID 103301189) has the molecular formula C13H6F4O and a molecular weight of 254.18 g/mol. Its IUPAC name is (2-fluorophenyl)-(2,4,5-trifluorophenyl)methanone.
| Compound Name | (2-fluorophenyl)-(2,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 103301189 |
| Molecular Formula | C13H6F4O |
| Molecular Weight | 254.18 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | (2-fluorophenyl)-(2,4,5-trifluorophenyl)methanone |
| SMILES | O=C(c1ccccc1F)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C13H6F4O/c14-9-4-2-1-3-7(9)13(18)8-5-11(16)12(17)6-10(8)15/h1-6H |
| InChIKey | MEEDYQDLPUHVKQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.18 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|