C13H11FN2O — CID 526486
(2,5-diaminophenyl)-(2-fluorophenyl)methanone (PubChem CID 526486) has the molecular formula C13H11FN2O and a molecular weight of 230.24 g/mol. Its IUPAC name is (2,5-diaminophenyl)-(2-fluorophenyl)methanone.
| Compound Name | (2,5-diaminophenyl)-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 526486 |
| Molecular Formula | C13H11FN2O |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | (2,5-diaminophenyl)-(2-fluorophenyl)methanone |
| SMILES | Nc1ccc(N)c(C(=O)c2ccccc2F)c1 |
| InChI | InChI=1S/C13H11FN2O/c14-11-4-2-1-3-9(11)13(17)10-7-8(15)5-6-12(10)16/h1-7H,15-16H2 |
| InChIKey | OKCCYEPCUCOYDR-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|