C17H8F2O9 — CID 67941508
4-(4,5-dicarboxy-2-fluorobenzoyl)-5-fluorophthalic acid (PubChem CID 67941508) has the molecular formula C17H8F2O9 and a molecular weight of 394.24 g/mol. Its IUPAC name is 4-(4,5-dicarboxy-2-fluorobenzoyl)-5-fluorophthalic acid.
| Compound Name | 4-(4,5-dicarboxy-2-fluorobenzoyl)-5-fluorophthalic acid |
|---|---|
| PubChem CID | 67941508 |
| Molecular Formula | C17H8F2O9 |
| Molecular Weight | 394.24 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 4-(4,5-dicarboxy-2-fluorobenzoyl)-5-fluorophthalic acid |
| SMILES | O=C(c1cc(C(=O)O)c(C(=O)O)cc1F)c1cc(C(=O)O)c(C(=O)O)cc1F |
| InChI | InChI=1S/C17H8F2O9/c18-11-3-7(16(25)26)5(14(21)22)1-9(11)13(20)10-2-6(15(23)24)8(17(27)28)4-12(10)19/h1-4H,(H,21,22)(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | AIDWYBQQFSBWNS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 166.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |