C17H16F4N2O — CID 56956390
bis[4-(dimethylamino)-2,5-difluorophenyl]methanone (PubChem CID 56956390) has the molecular formula C17H16F4N2O and a molecular weight of 340.32 g/mol. Its IUPAC name is bis[4-(dimethylamino)-2,5-difluorophenyl]methanone.
| Compound Name | bis[4-(dimethylamino)-2,5-difluorophenyl]methanone |
|---|---|
| PubChem CID | 56956390 |
| Molecular Formula | C17H16F4N2O |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | bis[4-(dimethylamino)-2,5-difluorophenyl]methanone |
| SMILES | CN(C)c1cc(F)c(C(=O)c2cc(F)c(N(C)C)cc2F)cc1F |
| InChI | InChI=1S/C17H16F4N2O/c1-22(2)15-7-11(18)9(5-13(15)20)17(24)10-6-14(21)16(23(3)4)8-12(10)19/h5-8H,1-4H3 |
| InChIKey | AFYPNITXMRJDHH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |