C13H7ClF3NO — CID 103304702
(3-amino-2-chlorophenyl)-(2,4,5-trifluorophenyl)methanone (PubChem CID 103304702) has the molecular formula C13H7ClF3NO and a molecular weight of 285.65 g/mol. Its IUPAC name is (3-amino-2-chlorophenyl)-(2,4,5-trifluorophenyl)methanone.
| Compound Name | (3-amino-2-chlorophenyl)-(2,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 103304702 |
| Molecular Formula | C13H7ClF3NO |
| Molecular Weight | 285.65 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | (3-amino-2-chlorophenyl)-(2,4,5-trifluorophenyl)methanone |
| SMILES | Nc1cccc(C(=O)c2cc(F)c(F)cc2F)c1Cl |
| InChI | InChI=1S/C13H7ClF3NO/c14-12-6(2-1-3-11(12)18)13(19)7-4-9(16)10(17)5-8(7)15/h1-5H,18H2 |
| InChIKey | RRNSXLYVXZICKV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.65 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|