C15H11BrClNO3 — CID 115937333
(3-amino-2-chlorophenyl)-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methanone (PubChem CID 115937333) has the molecular formula C15H11BrClNO3 and a molecular weight of 368.61 g/mol. Its IUPAC name is (3-amino-2-chlorophenyl)-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methanone.
| Compound Name | (3-amino-2-chlorophenyl)-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methanone |
|---|---|
| PubChem CID | 115937333 |
| Molecular Formula | C15H11BrClNO3 |
| Molecular Weight | 368.61 g/mol |
| Exact Mass | 366.96 |
| IUPAC Name | (3-amino-2-chlorophenyl)-(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methanone |
| SMILES | Nc1cccc(C(=O)c2cc3c(cc2Br)OCCO3)c1Cl |
| InChI | InChI=1S/C15H11BrClNO3/c16-10-7-13-12(20-4-5-21-13)6-9(10)15(19)8-2-1-3-11(18)14(8)17/h1-3,6-7H,4-5,18H2 |
| InChIKey | AZHNWMJZHYTFHQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.61 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|