C16H20ClN5O3S — CID 50939085
2-(5-chloro-2-methylphenyl)-1-(diaminomethylidene)guanidine;4-methylbenzenesulfonic acid (PubChem CID 50939085) has the molecular formula C16H20ClN5O3S and a molecular weight of 397.89 g/mol. Its IUPAC name is 2-(5-chloro-2-methylphenyl)-1-(diaminomethylidene)guanidine;4-methylbenzenesulfonic acid.
| Compound Name | 2-(5-chloro-2-methylphenyl)-1-(diaminomethylidene)guanidine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 50939085 |
| Molecular Formula | C16H20ClN5O3S |
| Molecular Weight | 397.89 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 2-(5-chloro-2-methylphenyl)-1-(diaminomethylidene)guanidine;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(Cl)cc1/N=C(\N)N=C(N)N.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C9H12ClN5.C7H8O3S/c1-5-2-3-6(10)4-7(5)14-9(13)15-8(11)12;1-6-2-4-7(5-3-6)11(8,9)10/h2-4H,1H3,(H6,11,12,13,14,15);2-5H,1H3,(H,8,9,10) |
| InChIKey | ROYFJPXJUSBIQA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 157.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.89 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|