C22H32N10 — CID 141007128
3-(diaminomethylidene)-1-[1-(N-[N-(diaminomethylidene)carbamimidoyl]-3,5-dimethylanilino)ethyl]-1-(3,5-dimethylphenyl)guanidine (PubChem CID 141007128) has the molecular formula C22H32N10 and a molecular weight of 436.57 g/mol. Its IUPAC name is 3-(diaminomethylidene)-1-[1-(N-[N-(diaminomethylidene)carbamimidoyl]-3,5-dimethylanilino)ethyl]-1-(3,5-dimethylphenyl)guanidine.
| Compound Name | 3-(diaminomethylidene)-1-[1-(N-[N-(diaminomethylidene)carbamimidoyl]-3,5-dimethylanilino)ethyl]-1-(3,5-dimethylphenyl)guanidine |
|---|---|
| PubChem CID | 141007128 |
| Molecular Formula | C22H32N10 |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | 3-(diaminomethylidene)-1-[1-(N-[N-(diaminomethylidene)carbamimidoyl]-3,5-dimethylanilino)ethyl]-1-(3,5-dimethylphenyl)guanidine |
| SMILES | [H]/N=C(\N=C(N)N)N(c1cc(C)cc(C)c1)C(C)N(/C(N=C(N)N)=N\[H])c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C22H32N10/c1-12-6-13(2)9-17(8-12)31(21(27)29-19(23)24)16(5)32(22(28)30-20(25)26)18-10-14(3)7-15(4)11-18/h6-11,16H,1-5H3,(H5,23,24,27,29)(H5,25,26,28,30) |
| InChIKey | FUYASTXIGOJEHO-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 182.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|