About 2-aminoacetic acid;2-methylguanidine
2-aminoacetic acid;2-methylguanidine (PubChem CID 175416544) has the molecular formula C4H12N4O2
and a molecular weight of 148.17 g/mol. Its IUPAC name is 2-aminoacetic acid;2-methylguanidine.
Molecular Properties
| Compound Name | 2-aminoacetic acid;2-methylguanidine |
| PubChem CID | 175416544 |
| Molecular Formula | C4H12N4O2 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 2-aminoacetic acid;2-methylguanidine |
| SMILES | CN=C(N)N.NCC(=O)O |
| InChI | InChI=1S/C2H7N3.C2H5NO2/c1-5-2(3)4;3-1-2(4)5/h1H3,(H4,3,4,5);1,3H2,(H,4,5) |
| InChIKey | ZVTYLENUECCRGZ-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoacetic acid;2-methylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetic acid;2-methylguanidine?
The IUPAC name of 2-aminoacetic acid;2-methylguanidine (CID 175416544) is 2-aminoacetic acid;2-methylguanidine.
What is the SMILES notation for 2-aminoacetic acid;2-methylguanidine?
The canonical SMILES for 2-aminoacetic acid;2-methylguanidine is CN=C(N)N.NCC(=O)O.
What is the InChIKey of 2-aminoacetic acid;2-methylguanidine?
The InChIKey is ZVTYLENUECCRGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7N3.C2H5NO2/c1-5-2(3)4;3-1-2(4)5/h1H3,(H4,3,4,5);1,3H2,(H,4,5).
What are the key properties of 2-aminoacetic acid;2-methylguanidine?
2-aminoacetic acid;2-methylguanidine has a molecular weight of 148.17 g/mol, XLogP of -2.08, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetic acid;2-methylguanidine is sourced from PubChem (CID 175416544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).