C3H10N8O — CID 174816814
1,3-diamino-1,3-dicarbamimidoylurea (PubChem CID 174816814) has the molecular formula C3H10N8O and a molecular weight of 174.17 g/mol. Its IUPAC name is 1,3-diamino-1,3-dicarbamimidoylurea.
| Compound Name | 1,3-diamino-1,3-dicarbamimidoylurea |
|---|---|
| PubChem CID | 174816814 |
| Molecular Formula | C3H10N8O |
| Molecular Weight | 174.17 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 1,3-diamino-1,3-dicarbamimidoylurea |
| SMILES | [H]/N=C(\N)N(N)C(=O)N(N)/C(N)=N/[H] |
| InChI | InChI=1S/C3H10N8O/c4-1(5)10(8)3(12)11(9)2(6)7/h8-9H2,(H3,4,5)(H3,6,7) |
| InChIKey | NACGKNLFUXNHDQ-UHFFFAOYSA-N |
| XLogP | -2.76 |
| TPSA | 175.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.17 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|