C5H12N4O4 — CID 156855314
1-carbamimidoyl-1,3,3-tris(hydroxymethyl)urea (PubChem CID 156855314) has the molecular formula C5H12N4O4 and a molecular weight of 192.17 g/mol. Its IUPAC name is 1-carbamimidoyl-1,3,3-tris(hydroxymethyl)urea.
| Compound Name | 1-carbamimidoyl-1,3,3-tris(hydroxymethyl)urea |
|---|---|
| PubChem CID | 156855314 |
| Molecular Formula | C5H12N4O4 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 1-carbamimidoyl-1,3,3-tris(hydroxymethyl)urea |
| SMILES | [H]/N=C(\N)N(CO)C(=O)N(CO)CO |
| InChI | InChI=1S/C5H12N4O4/c6-4(7)9(3-12)5(13)8(1-10)2-11/h10-12H,1-3H2,(H3,6,7) |
| InChIKey | OECBOQICSJYJIN-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 134.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|