C6H12N2O4 — CID 154134993
1-ethenyl-1,3,3-tris(hydroxymethyl)urea (PubChem CID 154134993) has the molecular formula C6H12N2O4 and a molecular weight of 176.17 g/mol. Its IUPAC name is 1-ethenyl-1,3,3-tris(hydroxymethyl)urea.
| Compound Name | 1-ethenyl-1,3,3-tris(hydroxymethyl)urea |
|---|---|
| PubChem CID | 154134993 |
| Molecular Formula | C6H12N2O4 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 1-ethenyl-1,3,3-tris(hydroxymethyl)urea |
| SMILES | C=CN(CO)C(=O)N(CO)CO |
| InChI | InChI=1S/C6H12N2O4/c1-2-7(3-9)6(12)8(4-10)5-11/h2,9-11H,1,3-5H2 |
| InChIKey | KBRYXYCPBRGMLG-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|