C6H11NO4 — CID 54415471
prop-2-enyl N,N-bis(hydroxymethyl)carbamate (PubChem CID 54415471) has the molecular formula C6H11NO4 and a molecular weight of 161.16 g/mol. Its IUPAC name is prop-2-enyl N,N-bis(hydroxymethyl)carbamate.
| Compound Name | prop-2-enyl N,N-bis(hydroxymethyl)carbamate |
|---|---|
| PubChem CID | 54415471 |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | prop-2-enyl N,N-bis(hydroxymethyl)carbamate |
| SMILES | C=CCOC(=O)N(CO)CO |
| InChI | InChI=1S/C6H11NO4/c1-2-3-11-6(10)7(4-8)5-9/h2,8-9H,1,3-5H2 |
| InChIKey | VXCJTJXVVKBBPT-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|