C30H51N3O12 — CID 164953178
2,2-dimethyl-3-[methyl(prop-2-enoxycarbonyl)amino]propanoic acid (PubChem CID 164953178) has the molecular formula C30H51N3O12 and a molecular weight of 645.75 g/mol. Its IUPAC name is 2,2-dimethyl-3-[methyl(prop-2-enoxycarbonyl)amino]propanoic acid.
| Compound Name | 2,2-dimethyl-3-[methyl(prop-2-enoxycarbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 164953178 |
| Molecular Formula | C30H51N3O12 |
| Molecular Weight | 645.75 g/mol |
| Exact Mass | 645.35 |
| IUPAC Name | 2,2-dimethyl-3-[methyl(prop-2-enoxycarbonyl)amino]propanoic acid |
| SMILES | C=CCOC(=O)N(C)CC(C)(C)C(=O)O.C=CCOC(=O)N(C)CC(C)(C)C(=O)O.C=CCOC(=O)N(C)CC(C)(C)C(=O)O |
| InChI | InChI=1S/3C10H17NO4/c3*1-5-6-15-9(14)11(4)7-10(2,3)8(12)13/h3*5H,1,6-7H2,2-4H3,(H,12,13) |
| InChIKey | AURSJFBNLOXUOO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 200.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.75 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|