C11H16N2O6 — CID 88657328
2,2-bis(prop-2-enoxycarbonylamino)propanoic acid (PubChem CID 88657328) has the molecular formula C11H16N2O6 and a molecular weight of 272.26 g/mol. Its IUPAC name is 2,2-bis(prop-2-enoxycarbonylamino)propanoic acid.
| Compound Name | 2,2-bis(prop-2-enoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 88657328 |
| Molecular Formula | C11H16N2O6 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2,2-bis(prop-2-enoxycarbonylamino)propanoic acid |
| SMILES | C=CCOC(=O)NC(C)(NC(=O)OCC=C)C(=O)O |
| InChI | InChI=1S/C11H16N2O6/c1-4-6-18-9(16)12-11(3,8(14)15)13-10(17)19-7-5-2/h4-5H,1-2,6-7H2,3H3,(H,12,16)(H,13,17)(H,14,15) |
| InChIKey | DNVMKWSTQFPOCF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|