C9H15NO6S — CID 167725948
2-methyl-3-methylsulfonyl-2-(prop-2-enoxycarbonylamino)propanoic acid (PubChem CID 167725948) has the molecular formula C9H15NO6S and a molecular weight of 265.29 g/mol. Its IUPAC name is 2-methyl-3-methylsulfonyl-2-(prop-2-enoxycarbonylamino)propanoic acid.
| Compound Name | 2-methyl-3-methylsulfonyl-2-(prop-2-enoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 167725948 |
| Molecular Formula | C9H15NO6S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 2-methyl-3-methylsulfonyl-2-(prop-2-enoxycarbonylamino)propanoic acid |
| SMILES | C=CCOC(=O)NC(C)(CS(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C9H15NO6S/c1-4-5-16-8(13)10-9(2,7(11)12)6-17(3,14)15/h4H,1,5-6H2,2-3H3,(H,10,13)(H,11,12) |
| InChIKey | OOQQBTKDWNZECR-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|