C13H24N2O3S — CID 174555964
prop-2-enyl N-[(2S)-2-amino-3-methylbutanoyl]-N-(2-methyl-2-sulfanylpropyl)carbamate (PubChem CID 174555964) has the molecular formula C13H24N2O3S and a molecular weight of 288.41 g/mol. Its IUPAC name is prop-2-enyl N-[(2S)-2-amino-3-methylbutanoyl]-N-(2-methyl-2-sulfanylpropyl)carbamate.
| Compound Name | prop-2-enyl N-[(2S)-2-amino-3-methylbutanoyl]-N-(2-methyl-2-sulfanylpropyl)carbamate |
|---|---|
| PubChem CID | 174555964 |
| Molecular Formula | C13H24N2O3S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | prop-2-enyl N-[(2S)-2-amino-3-methylbutanoyl]-N-(2-methyl-2-sulfanylpropyl)carbamate |
| SMILES | C=CCOC(=O)N(CC(C)(C)S)C(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C13H24N2O3S/c1-6-7-18-12(17)15(8-13(4,5)19)11(16)10(14)9(2)3/h6,9-10,19H,1,7-8,14H2,2-5H3/t10-/m0/s1 |
| InChIKey | PYRKDEWVVJFQSA-JTQLQIEISA-N |
| XLogP | 1.83 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|