C4H9NO5 — CID 139920036
hydroxymethyl N,N-bis(hydroxymethyl)carbamate (PubChem CID 139920036) has the molecular formula C4H9NO5 and a molecular weight of 151.12 g/mol. Its IUPAC name is hydroxymethyl N,N-bis(hydroxymethyl)carbamate.
| Compound Name | hydroxymethyl N,N-bis(hydroxymethyl)carbamate |
|---|---|
| PubChem CID | 139920036 |
| Molecular Formula | C4H9NO5 |
| Molecular Weight | 151.12 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | hydroxymethyl N,N-bis(hydroxymethyl)carbamate |
| SMILES | O=C(OCO)N(CO)CO |
| InChI | InChI=1S/C4H9NO5/c6-1-5(2-7)4(9)10-3-8/h6-8H,1-3H2 |
| InChIKey | MEPZEKJHAJRWSD-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.12 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|