C3H8N2O4 — CID 87879214
3-hydroxy-1,1-bis(hydroxymethyl)urea (PubChem CID 87879214) has the molecular formula C3H8N2O4 and a molecular weight of 136.11 g/mol. Its IUPAC name is 3-hydroxy-1,1-bis(hydroxymethyl)urea.
| Compound Name | 3-hydroxy-1,1-bis(hydroxymethyl)urea |
|---|---|
| PubChem CID | 87879214 |
| Molecular Formula | C3H8N2O4 |
| Molecular Weight | 136.11 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | 3-hydroxy-1,1-bis(hydroxymethyl)urea |
| SMILES | O=C(NO)N(CO)CO |
| InChI | InChI=1S/C3H8N2O4/c6-1-5(2-7)3(8)4-9/h6-7,9H,1-2H2,(H,4,8) |
| InChIKey | LYJKRXMDDNSXEW-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.11 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|