C8H17N3O6 — CID 59532811
2-methoxyethyl N-[[bis(hydroxymethyl)carbamoylamino]methyl]carbamate (PubChem CID 59532811) has the molecular formula C8H17N3O6 and a molecular weight of 251.24 g/mol. Its IUPAC name is 2-methoxyethyl N-[[bis(hydroxymethyl)carbamoylamino]methyl]carbamate.
| Compound Name | 2-methoxyethyl N-[[bis(hydroxymethyl)carbamoylamino]methyl]carbamate |
|---|---|
| PubChem CID | 59532811 |
| Molecular Formula | C8H17N3O6 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 2-methoxyethyl N-[[bis(hydroxymethyl)carbamoylamino]methyl]carbamate |
| SMILES | COCCOC(=O)NCNC(=O)N(CO)CO |
| InChI | InChI=1S/C8H17N3O6/c1-16-2-3-17-8(15)10-4-9-7(14)11(5-12)6-13/h12-13H,2-6H2,1H3,(H,9,14)(H,10,15) |
| InChIKey | UTHONZUETIRELD-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|