C5H10N2O6 — CID 20609208
hydroxymethyl N-[(hydroxymethoxycarbonylamino)methyl]carbamate (PubChem CID 20609208) has the molecular formula C5H10N2O6 and a molecular weight of 194.14 g/mol. Its IUPAC name is hydroxymethyl N-[(hydroxymethoxycarbonylamino)methyl]carbamate.
| Compound Name | hydroxymethyl N-[(hydroxymethoxycarbonylamino)methyl]carbamate |
|---|---|
| PubChem CID | 20609208 |
| Molecular Formula | C5H10N2O6 |
| Molecular Weight | 194.14 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | hydroxymethyl N-[(hydroxymethoxycarbonylamino)methyl]carbamate |
| SMILES | O=C(NCNC(=O)OCO)OCO |
| InChI | InChI=1S/C5H10N2O6/c8-2-12-4(10)6-1-7-5(11)13-3-9/h8-9H,1-3H2,(H,6,10)(H,7,11) |
| InChIKey | FELGKYLLTACJIX-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.14 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|