C11H22N2O6 — CID 59791185
2-hydroxybutyl N-[(2-hydroxybutoxycarbonylamino)methyl]carbamate (PubChem CID 59791185) has the molecular formula C11H22N2O6 and a molecular weight of 278.30 g/mol. Its IUPAC name is 2-hydroxybutyl N-[(2-hydroxybutoxycarbonylamino)methyl]carbamate.
| Compound Name | 2-hydroxybutyl N-[(2-hydroxybutoxycarbonylamino)methyl]carbamate |
|---|---|
| PubChem CID | 59791185 |
| Molecular Formula | C11H22N2O6 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-hydroxybutyl N-[(2-hydroxybutoxycarbonylamino)methyl]carbamate |
| SMILES | CCC(O)COC(=O)NCNC(=O)OCC(O)CC |
| InChI | InChI=1S/C11H22N2O6/c1-3-8(14)5-18-10(16)12-7-13-11(17)19-6-9(15)4-2/h8-9,14-15H,3-7H2,1-2H3,(H,12,16)(H,13,17) |
| InChIKey | VJDKTBJFVMVSTN-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|