C9H16N4O7 — CID 20683013
[2-[(methoxycarbonylamino)methylamino]-2-oxoethyl] N-[(methoxycarbonylamino)methyl]carbamate (PubChem CID 20683013) has the molecular formula C9H16N4O7 and a molecular weight of 292.25 g/mol. Its IUPAC name is [2-[(methoxycarbonylamino)methylamino]-2-oxoethyl] N-[(methoxycarbonylamino)methyl]carbamate.
| Compound Name | [2-[(methoxycarbonylamino)methylamino]-2-oxoethyl] N-[(methoxycarbonylamino)methyl]carbamate |
|---|---|
| PubChem CID | 20683013 |
| Molecular Formula | C9H16N4O7 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | [2-[(methoxycarbonylamino)methylamino]-2-oxoethyl] N-[(methoxycarbonylamino)methyl]carbamate |
| SMILES | COC(=O)NCNC(=O)COC(=O)NCNC(=O)OC |
| InChI | InChI=1S/C9H16N4O7/c1-18-7(15)11-4-10-6(14)3-20-9(17)13-5-12-8(16)19-2/h3-5H2,1-2H3,(H,10,14)(H,11,15)(H,12,16)(H,13,17) |
| InChIKey | QYAYJKWUMINXQV-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 144.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|