C9H16F2N2O5 — CID 91196206
methyl N-[[2-(2,2-difluoropropoxy)ethoxycarbonylamino]methyl]carbamate (PubChem CID 91196206) has the molecular formula C9H16F2N2O5 and a molecular weight of 270.23 g/mol. Its IUPAC name is methyl N-[[2-(2,2-difluoropropoxy)ethoxycarbonylamino]methyl]carbamate.
| Compound Name | methyl N-[[2-(2,2-difluoropropoxy)ethoxycarbonylamino]methyl]carbamate |
|---|---|
| PubChem CID | 91196206 |
| Molecular Formula | C9H16F2N2O5 |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | methyl N-[[2-(2,2-difluoropropoxy)ethoxycarbonylamino]methyl]carbamate |
| SMILES | COC(=O)NCNC(=O)OCCOCC(C)(F)F |
| InChI | InChI=1S/C9H16F2N2O5/c1-9(10,11)5-17-3-4-18-8(15)13-6-12-7(14)16-2/h3-6H2,1-2H3,(H,12,14)(H,13,15) |
| InChIKey | WCYOOAPNOCKHRM-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|