C10H18N4O8 — CID 20674168
(methoxycarbonylamino)methylcarbamoyloxymethyl N-[(ethoxycarbonylamino)methyl]carbamate (PubChem CID 20674168) has the molecular formula C10H18N4O8 and a molecular weight of 322.27 g/mol. Its IUPAC name is (methoxycarbonylamino)methylcarbamoyloxymethyl N-[(ethoxycarbonylamino)methyl]carbamate.
| Compound Name | (methoxycarbonylamino)methylcarbamoyloxymethyl N-[(ethoxycarbonylamino)methyl]carbamate |
|---|---|
| PubChem CID | 20674168 |
| Molecular Formula | C10H18N4O8 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | (methoxycarbonylamino)methylcarbamoyloxymethyl N-[(ethoxycarbonylamino)methyl]carbamate |
| SMILES | CCOC(=O)NCNC(=O)OCOC(=O)NCNC(=O)OC |
| InChI | InChI=1S/C10H18N4O8/c1-3-20-8(16)12-5-14-10(18)22-6-21-9(17)13-4-11-7(15)19-2/h3-6H2,1-2H3,(H,11,15)(H,12,16)(H,13,17)(H,14,18) |
| InChIKey | RXTCGXWBCTZWHN-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|