C10H20N2O4 — CID 21120319
(2S)-2-[(ethoxycarbonylamino)methylamino]-3-methylpentanoic acid (PubChem CID 21120319) has the molecular formula C10H20N2O4 and a molecular weight of 232.28 g/mol. Its IUPAC name is (2S)-2-[(ethoxycarbonylamino)methylamino]-3-methylpentanoic acid.
| Compound Name | (2S)-2-[(ethoxycarbonylamino)methylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 21120319 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | (2S)-2-[(ethoxycarbonylamino)methylamino]-3-methylpentanoic acid |
| SMILES | CCOC(=O)NCN[C@H](C(=O)O)C(C)CC |
| InChI | InChI=1S/C10H20N2O4/c1-4-7(3)8(9(13)14)11-6-12-10(15)16-5-2/h7-8,11H,4-6H2,1-3H3,(H,12,15)(H,13,14)/t7?,8-/m0/s1 |
| InChIKey | SCNSGPWOIGVSNJ-MQWKRIRWSA-N |
| XLogP | 0.78 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|