C9H14N2O8 — CID 54556064
3-O-(acetamidomethylcarbamoyloxymethyl) 1-O-(hydroxymethyl) propanedioate (PubChem CID 54556064) has the molecular formula C9H14N2O8 and a molecular weight of 278.22 g/mol. Its IUPAC name is 3-O-(acetamidomethylcarbamoyloxymethyl) 1-O-(hydroxymethyl) propanedioate.
| Compound Name | 3-O-(acetamidomethylcarbamoyloxymethyl) 1-O-(hydroxymethyl) propanedioate |
|---|---|
| PubChem CID | 54556064 |
| Molecular Formula | C9H14N2O8 |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 3-O-(acetamidomethylcarbamoyloxymethyl) 1-O-(hydroxymethyl) propanedioate |
| SMILES | CC(=O)NCNC(=O)OCOC(=O)CC(=O)OCO |
| InChI | InChI=1S/C9H14N2O8/c1-6(13)10-3-11-9(16)19-5-18-8(15)2-7(14)17-4-12/h12H,2-5H2,1H3,(H,10,13)(H,11,16) |
| InChIKey | ZNGDTIVVKUZZJL-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 140.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|