C19H30N2O12 — CID 59464762
[1-[2-[2-[2-(acetamidomethylcarbamoyloxy)propanoyloxy]propanoyloxy]ethoxy]-1-oxopropan-2-yl] 2-methoxypropanoate (PubChem CID 59464762) has the molecular formula C19H30N2O12 and a molecular weight of 478.45 g/mol. Its IUPAC name is [1-[2-[2-[2-(acetamidomethylcarbamoyloxy)propanoyloxy]propanoyloxy]ethoxy]-1-oxopropan-2-yl] 2-methoxypropanoate.
| Compound Name | [1-[2-[2-[2-(acetamidomethylcarbamoyloxy)propanoyloxy]propanoyloxy]ethoxy]-1-oxopropan-2-yl] 2-methoxypropanoate |
|---|---|
| PubChem CID | 59464762 |
| Molecular Formula | C19H30N2O12 |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | [1-[2-[2-[2-(acetamidomethylcarbamoyloxy)propanoyloxy]propanoyloxy]ethoxy]-1-oxopropan-2-yl] 2-methoxypropanoate |
| SMILES | COC(C)C(=O)OC(C)C(=O)OCCOC(=O)C(C)OC(=O)C(C)OC(=O)NCNC(C)=O |
| InChI | InChI=1S/C19H30N2O12/c1-10(28-6)17(25)31-11(2)15(23)29-7-8-30-16(24)12(3)32-18(26)13(4)33-19(27)21-9-20-14(5)22/h10-13H,7-9H2,1-6H3,(H,20,22)(H,21,27) |
| InChIKey | RZPPLUACVMDJOJ-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 181.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|