C23H41O12P — CID 59919176
[(2R)-1-[2-[(2S)-2-[(2S)-2-[ethyl(hexoxy)phosphoryl]oxypropanoyl]oxypropanoyl]oxyethoxy]-1-oxopropan-2-yl] (2R)-2-methoxypropanoate (PubChem CID 59919176) has the molecular formula C23H41O12P and a molecular weight of 540.54 g/mol. Its IUPAC name is [(2R)-1-[2-[(2S)-2-[(2S)-2-[ethyl(hexoxy)phosphoryl]oxypropanoyl]oxypropanoyl]oxyethoxy]-1-oxopropan-2-yl] (2R)-2-methoxypropanoate.
| Compound Name | [(2R)-1-[2-[(2S)-2-[(2S)-2-[ethyl(hexoxy)phosphoryl]oxypropanoyl]oxypropanoyl]oxyethoxy]-1-oxopropan-2-yl] (2R)-2-methoxypropanoate |
|---|---|
| PubChem CID | 59919176 |
| Molecular Formula | C23H41O12P |
| Molecular Weight | 540.54 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | [(2R)-1-[2-[(2S)-2-[(2S)-2-[ethyl(hexoxy)phosphoryl]oxypropanoyl]oxypropanoyl]oxyethoxy]-1-oxopropan-2-yl] (2R)-2-methoxypropanoate |
| SMILES | CCCCCCO[P@@](=O)(CC)O[C@@H](C)C(=O)O[C@@H](C)C(=O)OCCOC(=O)[C@@H](C)OC(=O)[C@@H](C)OC |
| InChI | InChI=1S/C23H41O12P/c1-8-10-11-12-13-32-36(28,9-2)35-19(6)23(27)34-18(5)21(25)31-15-14-30-20(24)17(4)33-22(26)16(3)29-7/h16-19H,8-15H2,1-7H3/t16-,17-,18+,19+,36+/m1/s1 |
| InChIKey | LSNHOGQOOJAGAU-SXQJGJROSA-N |
| XLogP | 3.19 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|