C24H44N2O12 — CID 159854440
1-O-[2-[2-[2-(acetamidomethylcarbamoyloxy)ethoxy]propoxy]ethyl] 5-O-[2-[1-(2-methoxyethoxy)propan-2-yloxy]ethyl] pentanedioate (PubChem CID 159854440) has the molecular formula C24H44N2O12 and a molecular weight of 552.62 g/mol. Its IUPAC name is 1-O-[2-[2-[2-(acetamidomethylcarbamoyloxy)ethoxy]propoxy]ethyl] 5-O-[2-[1-(2-methoxyethoxy)propan-2-yloxy]ethyl] pentanedioate.
| Compound Name | 1-O-[2-[2-[2-(acetamidomethylcarbamoyloxy)ethoxy]propoxy]ethyl] 5-O-[2-[1-(2-methoxyethoxy)propan-2-yloxy]ethyl] pentanedioate |
|---|---|
| PubChem CID | 159854440 |
| Molecular Formula | C24H44N2O12 |
| Molecular Weight | 552.62 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | 1-O-[2-[2-[2-(acetamidomethylcarbamoyloxy)ethoxy]propoxy]ethyl] 5-O-[2-[1-(2-methoxyethoxy)propan-2-yloxy]ethyl] pentanedioate |
| SMILES | COCCOCC(C)OCCOC(=O)CCCC(=O)OCCOCC(C)OCCOC(=O)NCNC(C)=O |
| InChI | InChI=1S/C24H44N2O12/c1-19(16-32-9-8-31-4)34-12-14-37-23(29)7-5-6-22(28)36-11-10-33-17-20(2)35-13-15-38-24(30)26-18-25-21(3)27/h19-20H,5-18H2,1-4H3,(H,25,27)(H,26,30) |
| InChIKey | NQIPMSJFWPXJDB-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 166.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.62 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|