C11H18N2O8 — CID 59464765
2-[2-(acetamidomethylcarbamoyloxy)acetyl]oxyethyl 2-methoxyacetate (PubChem CID 59464765) has the molecular formula C11H18N2O8 and a molecular weight of 306.27 g/mol. Its IUPAC name is 2-[2-(acetamidomethylcarbamoyloxy)acetyl]oxyethyl 2-methoxyacetate.
| Compound Name | 2-[2-(acetamidomethylcarbamoyloxy)acetyl]oxyethyl 2-methoxyacetate |
|---|---|
| PubChem CID | 59464765 |
| Molecular Formula | C11H18N2O8 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 2-[2-(acetamidomethylcarbamoyloxy)acetyl]oxyethyl 2-methoxyacetate |
| SMILES | COCC(=O)OCCOC(=O)COC(=O)NCNC(C)=O |
| InChI | InChI=1S/C11H18N2O8/c1-8(14)12-7-13-11(17)21-6-10(16)20-4-3-19-9(15)5-18-2/h3-7H2,1-2H3,(H,12,14)(H,13,17) |
| InChIKey | JKJJCMDTCASWHV-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|