C7H14N2O6 — CID 59934481
methoxymethyl N-[(methoxymethoxycarbonylamino)methyl]carbamate (PubChem CID 59934481) has the molecular formula C7H14N2O6 and a molecular weight of 222.20 g/mol. Its IUPAC name is methoxymethyl N-[(methoxymethoxycarbonylamino)methyl]carbamate.
| Compound Name | methoxymethyl N-[(methoxymethoxycarbonylamino)methyl]carbamate |
|---|---|
| PubChem CID | 59934481 |
| Molecular Formula | C7H14N2O6 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | methoxymethyl N-[(methoxymethoxycarbonylamino)methyl]carbamate |
| SMILES | COCOC(=O)NCNC(=O)OCOC |
| InChI | InChI=1S/C7H14N2O6/c1-12-4-14-6(10)8-3-9-7(11)15-5-13-2/h3-5H2,1-2H3,(H,8,10)(H,9,11) |
| InChIKey | GBGLXGDPUHHQNV-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|